C12H12BFN2 — CID 156801946
CID 156801946 (PubChem CID 156801946) has the molecular formula C12H12BFN2 and a molecular weight of 214.05 g/mol.
| Compound Name | CID 156801946 |
|---|---|
| PubChem CID | 156801946 |
| Molecular Formula | C12H12BFN2 |
| Molecular Weight | 214.05 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(NCC(=C)/C=C\C(=C)F)nc1 |
| InChI | InChI=1S/C12H12BFN2/c1-9(3-4-10(2)14)7-15-12-6-5-11(13)8-16-12/h3-6,8H,1-2,7H2,(H,15,16)/b4-3- |
| InChIKey | JFHQIEVHAJVLMY-ARJAWSKDSA-N |
| XLogP | 1.88 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.05 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|