About N-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]methyl]formamide
N-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]methyl]formamide (PubChem CID 156802697) has the molecular formula C13H15N3O
and a molecular weight of 229.28 g/mol. Its IUPAC name is N-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]methyl]formamide.
Molecular Properties
| Compound Name | N-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]methyl]formamide |
| PubChem CID | 156802697 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | N-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]methyl]formamide |
| SMILES | Cc1n[nH]c(C)c1-c1ccc(CNC=O)cc1 |
| InChI | InChI=1S/C13H15N3O/c1-9-13(10(2)16-15-9)12-5-3-11(4-6-12)7-14-8-17/h3-6,8H,7H2,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | SZINFOGAJFISDC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]methyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]methyl]formamide?
The IUPAC name of N-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]methyl]formamide (CID 156802697) is N-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]methyl]formamide.
What is the SMILES notation for N-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]methyl]formamide?
The canonical SMILES for N-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]methyl]formamide is Cc1n[nH]c(C)c1-c1ccc(CNC=O)cc1.
What is the InChIKey of N-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]methyl]formamide?
The InChIKey is SZINFOGAJFISDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O/c1-9-13(10(2)16-15-9)12-5-3-11(4-6-12)7-14-8-17/h3-6,8H,7H2,1-2H3,(H,14,17)(H,15,16).
What are the key properties of N-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]methyl]formamide?
N-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]methyl]formamide has a molecular weight of 229.28 g/mol, XLogP of 1.94, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]methyl]formamide is sourced from PubChem (CID 156802697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).