C13H15N3O — CID 156802697
N-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]methyl]formamide (PubChem CID 156802697) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is N-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]methyl]formamide.
| Compound Name | N-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]methyl]formamide |
|---|---|
| PubChem CID | 156802697 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | N-[[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]methyl]formamide |
| SMILES | Cc1n[nH]c(C)c1-c1ccc(CNC=O)cc1 |
| InChI | InChI=1S/C13H15N3O/c1-9-13(10(2)16-15-9)12-5-3-11(4-6-12)7-14-8-17/h3-6,8H,7H2,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | SZINFOGAJFISDC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|