C37H50N4O6Si2 — CID 156803766
tert-butyl-[5-[tert-butyl(dimethyl)silyl]oxy-2-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(3-nitrophenyl)methyl]triazol-4-yl]-4-ethylphenoxy]-dimethylsilane (PubChem CID 156803766) has the molecular formula C37H50N4O6Si2 and a molecular weight of 703.00 g/mol. Its IUPAC name is tert-butyl-[5-[tert-butyl(dimethyl)silyl]oxy-2-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(3-nitrophenyl)methyl]triazol-4-yl]-4-ethylphenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[5-[tert-butyl(dimethyl)silyl]oxy-2-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(3-nitrophenyl)methyl]triazol-4-yl]-4-ethylphenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 156803766 |
| Molecular Formula | C37H50N4O6Si2 |
| Molecular Weight | 703.00 g/mol |
| Exact Mass | 702.33 |
| IUPAC Name | tert-butyl-[5-[tert-butyl(dimethyl)silyl]oxy-2-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(3-nitrophenyl)methyl]triazol-4-yl]-4-ethylphenoxy]-dimethylsilane |
| SMILES | CCc1cc(-c2nnn(Cc3cccc([N+](=O)[O-])c3)c2-c2ccc3c(c2)OCCO3)c(O[Si](C)(C)C(C)(C)C)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H50N4O6Si2/c1-12-26-21-29(32(47-49(10,11)37(5,6)7)23-31(26)46-48(8,9)36(2,3)4)34-35(27-16-17-30-33(22-27)45-19-18-44-30)40(39-38-34)24-25-14-13-15-28(20-25)41(42)43/h13-17,20-23H,12,18-19,24H2,1-11H3 |
| InChIKey | WVORDOHDFHXRMW-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 110.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.00 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|