C25H21FN4O6 — CID 156565316
4-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(2-fluoro-6-nitrophenyl)methyl]triazol-4-yl]-6-ethylbenzene-1,3-diol (PubChem CID 156565316) has the molecular formula C25H21FN4O6 and a molecular weight of 492.46 g/mol. Its IUPAC name is 4-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(2-fluoro-6-nitrophenyl)methyl]triazol-4-yl]-6-ethylbenzene-1,3-diol.
| Compound Name | 4-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(2-fluoro-6-nitrophenyl)methyl]triazol-4-yl]-6-ethylbenzene-1,3-diol |
|---|---|
| PubChem CID | 156565316 |
| Molecular Formula | C25H21FN4O6 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 4-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(2-fluoro-6-nitrophenyl)methyl]triazol-4-yl]-6-ethylbenzene-1,3-diol |
| SMILES | CCc1cc(-c2nnn(Cc3c(F)cccc3[N+](=O)[O-])c2-c2ccc3c(c2)OCCO3)c(O)cc1O |
| InChI | InChI=1S/C25H21FN4O6/c1-2-14-10-16(21(32)12-20(14)31)24-25(15-6-7-22-23(11-15)36-9-8-35-22)29(28-27-24)13-17-18(26)4-3-5-19(17)30(33)34/h3-7,10-12,31-32H,2,8-9,13H2,1H3 |
| InChIKey | QTKNBHLUSYKEOQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 132.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|