C29H42FIN4O4Si2 — CID 156803771
tert-butyl-[5-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-4-[1-[(2-fluoro-6-nitrophenyl)methyl]-5-iodotriazol-4-yl]phenoxy]-dimethylsilane (PubChem CID 156803771) has the molecular formula C29H42FIN4O4Si2 and a molecular weight of 712.75 g/mol. Its IUPAC name is tert-butyl-[5-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-4-[1-[(2-fluoro-6-nitrophenyl)methyl]-5-iodotriazol-4-yl]phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[5-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-4-[1-[(2-fluoro-6-nitrophenyl)methyl]-5-iodotriazol-4-yl]phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 156803771 |
| Molecular Formula | C29H42FIN4O4Si2 |
| Molecular Weight | 712.75 g/mol |
| Exact Mass | 712.18 |
| IUPAC Name | tert-butyl-[5-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-4-[1-[(2-fluoro-6-nitrophenyl)methyl]-5-iodotriazol-4-yl]phenoxy]-dimethylsilane |
| SMILES | CCc1cc(-c2nnn(Cc3c(F)cccc3[N+](=O)[O-])c2I)c(O[Si](C)(C)C(C)(C)C)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H42FIN4O4Si2/c1-12-19-16-20(26-27(31)34(33-32-26)18-21-22(30)14-13-15-23(21)35(36)37)25(39-41(10,11)29(5,6)7)17-24(19)38-40(8,9)28(2,3)4/h13-17H,12,18H2,1-11H3 |
| InChIKey | JLDCMMIPUDDBEY-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 92.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.75 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|