C16H33N3O4 — CID 156804456
3-amino-5-methyl-4-oxohexanoic acid;4,8-diamino-2-methyloctan-3-one (PubChem CID 156804456) has the molecular formula C16H33N3O4 and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-amino-5-methyl-4-oxohexanoic acid;4,8-diamino-2-methyloctan-3-one.
| Compound Name | 3-amino-5-methyl-4-oxohexanoic acid;4,8-diamino-2-methyloctan-3-one |
|---|---|
| PubChem CID | 156804456 |
| Molecular Formula | C16H33N3O4 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | 3-amino-5-methyl-4-oxohexanoic acid;4,8-diamino-2-methyloctan-3-one |
| SMILES | CC(C)C(=O)C(N)CC(=O)O.CC(C)C(=O)C(N)CCCCN |
| InChI | InChI=1S/C9H20N2O.C7H13NO3/c1-7(2)9(12)8(11)5-3-4-6-10;1-4(2)7(11)5(8)3-6(9)10/h7-8H,3-6,10-11H2,1-2H3;4-5H,3,8H2,1-2H3,(H,9,10) |
| InChIKey | KYDLAUXLTYCIOF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 149.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|