C19H13FN4S — CID 156804996
5-fluoro-1-(2-methylthieno[2,3-g]quinolin-8-yl)indazol-3-amine (PubChem CID 156804996) has the molecular formula C19H13FN4S and a molecular weight of 348.41 g/mol. Its IUPAC name is 5-fluoro-1-(2-methylthieno[2,3-g]quinolin-8-yl)indazol-3-amine.
| Compound Name | 5-fluoro-1-(2-methylthieno[2,3-g]quinolin-8-yl)indazol-3-amine |
|---|---|
| PubChem CID | 156804996 |
| Molecular Formula | C19H13FN4S |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 5-fluoro-1-(2-methylthieno[2,3-g]quinolin-8-yl)indazol-3-amine |
| SMILES | Cc1cc2cc3nccc(-n4nc(N)c5cc(F)ccc54)c3cc2s1 |
| InChI | InChI=1S/C19H13FN4S/c1-10-6-11-7-15-13(9-18(11)25-10)17(4-5-22-15)24-16-3-2-12(20)8-14(16)19(21)23-24/h2-9H,1H3,(H2,21,23) |
| InChIKey | PXPJHAUODKJKLI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |