C26H36N4O3S — CID 156806659
N-[3-(2-methyl-1H-indol-3-yl)propyl]-4-[3-(4-methylpiperazin-1-yl)propoxy]benzenesulfonamide (PubChem CID 156806659) has the molecular formula C26H36N4O3S and a molecular weight of 484.67 g/mol. Its IUPAC name is N-[3-(2-methyl-1H-indol-3-yl)propyl]-4-[3-(4-methylpiperazin-1-yl)propoxy]benzenesulfonamide.
| Compound Name | N-[3-(2-methyl-1H-indol-3-yl)propyl]-4-[3-(4-methylpiperazin-1-yl)propoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 156806659 |
| Molecular Formula | C26H36N4O3S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | N-[3-(2-methyl-1H-indol-3-yl)propyl]-4-[3-(4-methylpiperazin-1-yl)propoxy]benzenesulfonamide |
| SMILES | Cc1[nH]c2ccccc2c1CCCNS(=O)(=O)c1ccc(OCCCN2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C26H36N4O3S/c1-21-24(25-7-3-4-9-26(25)28-21)8-5-14-27-34(31,32)23-12-10-22(11-13-23)33-20-6-15-30-18-16-29(2)17-19-30/h3-4,7,9-13,27-28H,5-6,8,14-20H2,1-2H3 |
| InChIKey | HGMWCKIQEIWOQS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|