C24H47NO2 — CID 156806919
(1S)-1-[6-[2-(3,7-dimethyloct-6-enoxy)-1,2-dimethylcyclopropyl]-3-methylhexoxy]ethanamine (PubChem CID 156806919) has the molecular formula C24H47NO2 and a molecular weight of 381.65 g/mol. Its IUPAC name is (1S)-1-[6-[2-(3,7-dimethyloct-6-enoxy)-1,2-dimethylcyclopropyl]-3-methylhexoxy]ethanamine.
| Compound Name | (1S)-1-[6-[2-(3,7-dimethyloct-6-enoxy)-1,2-dimethylcyclopropyl]-3-methylhexoxy]ethanamine |
|---|---|
| PubChem CID | 156806919 |
| Molecular Formula | C24H47NO2 |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 381.36 |
| IUPAC Name | (1S)-1-[6-[2-(3,7-dimethyloct-6-enoxy)-1,2-dimethylcyclopropyl]-3-methylhexoxy]ethanamine |
| SMILES | CC(C)=CCCC(C)CCOC1(C)CC1(C)CCCC(C)CCO[C@@H](C)N |
| InChI | InChI=1S/C24H47NO2/c1-19(2)10-8-11-20(3)14-17-27-24(7)18-23(24,6)15-9-12-21(4)13-16-26-22(5)25/h10,20-22H,8-9,11-18,25H2,1-7H3/t20?,21?,22-,23?,24?/m0/s1 |
| InChIKey | CHSUQEATJNUCRR-NCYNLMRGSA-N |
| XLogP | 6.46 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|