C24H23ClN2OS — CID 156810114
2-[[(4R)-2-chloro-4-[2-(5,6-dimethyl-3-pyridinyl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]methyl]prop-2-enal (PubChem CID 156810114) has the molecular formula C24H23ClN2OS and a molecular weight of 422.98 g/mol. Its IUPAC name is 2-[[(4R)-2-chloro-4-[2-(5,6-dimethyl-3-pyridinyl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]methyl]prop-2-enal.
| Compound Name | 2-[[(4R)-2-chloro-4-[2-(5,6-dimethyl-3-pyridinyl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]methyl]prop-2-enal |
|---|---|
| PubChem CID | 156810114 |
| Molecular Formula | C24H23ClN2OS |
| Molecular Weight | 422.98 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-[[(4R)-2-chloro-4-[2-(5,6-dimethyl-3-pyridinyl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]methyl]prop-2-enal |
| SMILES | C=C(C=O)CN1Cc2sc(Cl)cc2[C@@H](c2ccccc2-c2cnc(C)c(C)c2)C1 |
| InChI | InChI=1S/C24H23ClN2OS/c1-15(14-28)11-27-12-22(21-9-24(25)29-23(21)13-27)20-7-5-4-6-19(20)18-8-16(2)17(3)26-10-18/h4-10,14,22H,1,11-13H2,2-3H3/t22-/m1/s1 |
| InChIKey | KRFHRENBHSPEEK-JOCHJYFZSA-N |
| XLogP | 5.78 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.98 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|