C22H19ClFN3S — CID 170149962
1-[(4R)-2-chloro-4-[2-(6-fluoro-5-methyl-3-pyridinyl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-imine (PubChem CID 170149962) has the molecular formula C22H19ClFN3S and a molecular weight of 411.93 g/mol. Its IUPAC name is 1-[(4R)-2-chloro-4-[2-(6-fluoro-5-methyl-3-pyridinyl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-imine.
| Compound Name | 1-[(4R)-2-chloro-4-[2-(6-fluoro-5-methyl-3-pyridinyl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 170149962 |
| Molecular Formula | C22H19ClFN3S |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 1-[(4R)-2-chloro-4-[2-(6-fluoro-5-methyl-3-pyridinyl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-imine |
| SMILES | [H]/N=C(\C=C)N1Cc2sc(Cl)cc2[C@@H](c2ccccc2-c2cnc(F)c(C)c2)C1 |
| InChI | InChI=1S/C22H19ClFN3S/c1-3-21(25)27-11-18(17-9-20(23)28-19(17)12-27)16-7-5-4-6-15(16)14-8-13(2)22(24)26-10-14/h3-10,18,25H,1,11-12H2,2H3/b25-21+/t18-/m1/s1 |
| InChIKey | OGMRXECWXISRSV-IQWWUADYSA-N |
| XLogP | 6.02 |
| TPSA | 39.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|