C20H19N3S2 — CID 170150079
1-[(4R)-2-methyl-4-[2-(1,2-thiazol-4-yl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-imine (PubChem CID 170150079) has the molecular formula C20H19N3S2 and a molecular weight of 365.53 g/mol. Its IUPAC name is 1-[(4R)-2-methyl-4-[2-(1,2-thiazol-4-yl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-imine.
| Compound Name | 1-[(4R)-2-methyl-4-[2-(1,2-thiazol-4-yl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 170150079 |
| Molecular Formula | C20H19N3S2 |
| Molecular Weight | 365.53 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 1-[(4R)-2-methyl-4-[2-(1,2-thiazol-4-yl)phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]prop-2-en-1-imine |
| SMILES | [H]/N=C(\C=C)N1Cc2sc(C)cc2[C@@H](c2ccccc2-c2cnsc2)C1 |
| InChI | InChI=1S/C20H19N3S2/c1-3-20(21)23-10-18(17-8-13(2)25-19(17)11-23)16-7-5-4-6-15(16)14-9-22-24-12-14/h3-9,12,18,21H,1,10-11H2,2H3/b21-20+/t18-/m1/s1 |
| InChIKey | NIOZJLJTVRGPHL-PNBGARPFSA-N |
| XLogP | 5.29 |
| TPSA | 39.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|