C21H25ClN4S — CID 156810286
N-(aminomethylidene)-2-(2-chloro-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-yl)-N'-methylbenzenecarboximidamide;buta-1,3-diene (PubChem CID 156810286) has the molecular formula C21H25ClN4S and a molecular weight of 400.98 g/mol. Its IUPAC name is N-(aminomethylidene)-2-(2-chloro-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-yl)-N'-methylbenzenecarboximidamide;buta-1,3-diene.
| Compound Name | N-(aminomethylidene)-2-(2-chloro-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-yl)-N'-methylbenzenecarboximidamide;buta-1,3-diene |
|---|---|
| PubChem CID | 156810286 |
| Molecular Formula | C21H25ClN4S |
| Molecular Weight | 400.98 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-(aminomethylidene)-2-(2-chloro-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-4-yl)-N'-methylbenzenecarboximidamide;buta-1,3-diene |
| SMILES | C/N=C(\N=C\N)c1ccccc1C1CN(C)Cc2sc(Cl)cc21.C=CC=C |
| InChI | InChI=1S/C17H19ClN4S.C4H6/c1-20-17(21-10-19)12-6-4-3-5-11(12)14-8-22(2)9-15-13(14)7-16(18)23-15;1-3-4-2/h3-7,10,14H,8-9H2,1-2H3,(H2,19,20,21);3-4H,1-2H2 |
| InChIKey | FOYQGAVCYUNUOH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.98 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|