C21H20F2N4O2 — CID 156811157
5-[2-amino-4-(4,4-difluoropiperidine-1-carbonyl)benzenecarboximidoyl]-2,3-dihydroisoindol-1-one (PubChem CID 156811157) has the molecular formula C21H20F2N4O2 and a molecular weight of 398.41 g/mol. Its IUPAC name is 5-[2-amino-4-(4,4-difluoropiperidine-1-carbonyl)benzenecarboximidoyl]-2,3-dihydroisoindol-1-one.
| Compound Name | 5-[2-amino-4-(4,4-difluoropiperidine-1-carbonyl)benzenecarboximidoyl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 156811157 |
| Molecular Formula | C21H20F2N4O2 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 5-[2-amino-4-(4,4-difluoropiperidine-1-carbonyl)benzenecarboximidoyl]-2,3-dihydroisoindol-1-one |
| SMILES | [H]/N=C(\c1ccc2c(c1)CNC2=O)c1ccc(C(=O)N2CCC(F)(F)CC2)cc1N |
| InChI | InChI=1S/C21H20F2N4O2/c22-21(23)5-7-27(8-6-21)20(29)13-2-4-16(17(24)10-13)18(25)12-1-3-15-14(9-12)11-26-19(15)28/h1-4,9-10,25H,5-8,11,24H2,(H,26,28)/b25-18+ |
| InChIKey | TUPACUUIPKOWCO-XIEYBQDHSA-N |
| XLogP | 2.80 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|