C25H32N4O3 — CID 156812140
6-(diethylamino)-N-(3-methoxynaphthalen-1-yl)-2-pentoxypyrimidine-4-carboxamide (PubChem CID 156812140) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is 6-(diethylamino)-N-(3-methoxynaphthalen-1-yl)-2-pentoxypyrimidine-4-carboxamide.
| Compound Name | 6-(diethylamino)-N-(3-methoxynaphthalen-1-yl)-2-pentoxypyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 156812140 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 6-(diethylamino)-N-(3-methoxynaphthalen-1-yl)-2-pentoxypyrimidine-4-carboxamide |
| SMILES | CCCCCOc1nc(C(=O)Nc2cc(OC)cc3ccccc23)cc(N(CC)CC)n1 |
| InChI | InChI=1S/C25H32N4O3/c1-5-8-11-14-32-25-27-22(17-23(28-25)29(6-2)7-3)24(30)26-21-16-19(31-4)15-18-12-9-10-13-20(18)21/h9-10,12-13,15-17H,5-8,11,14H2,1-4H3,(H,26,30) |
| InChIKey | MSYUKRKNFIOCEE-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|