C28H35N3O3 — CID 156814634
2,6-dimethylpyridine;3-[4-(2-ethylphenoxy)-2-formylphenyl]pyrrolidine-1-carbaldehyde;methanamine (PubChem CID 156814634) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is 2,6-dimethylpyridine;3-[4-(2-ethylphenoxy)-2-formylphenyl]pyrrolidine-1-carbaldehyde;methanamine.
| Compound Name | 2,6-dimethylpyridine;3-[4-(2-ethylphenoxy)-2-formylphenyl]pyrrolidine-1-carbaldehyde;methanamine |
|---|---|
| PubChem CID | 156814634 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | 2,6-dimethylpyridine;3-[4-(2-ethylphenoxy)-2-formylphenyl]pyrrolidine-1-carbaldehyde;methanamine |
| SMILES | CCc1ccccc1Oc1ccc(C2CCN(C=O)C2)c(C=O)c1.CN.Cc1cccc(C)n1 |
| InChI | InChI=1S/C20H21NO3.C7H9N.CH5N/c1-2-15-5-3-4-6-20(15)24-18-7-8-19(17(11-18)13-22)16-9-10-21(12-16)14-23;1-6-4-3-5-7(2)8-6;1-2/h3-8,11,13-14,16H,2,9-10,12H2,1H3;3-5H,1-2H3;2H2,1H3 |
| InChIKey | WQELLEHHNIZLJE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|