C29H37N3O3 — CID 156815074
2,6-dimethylpyridine;3-[2-formyl-4-(2-propan-2-ylphenoxy)phenyl]pyrrolidine-1-carbaldehyde;methanamine (PubChem CID 156815074) has the molecular formula C29H37N3O3 and a molecular weight of 475.63 g/mol. Its IUPAC name is 2,6-dimethylpyridine;3-[2-formyl-4-(2-propan-2-ylphenoxy)phenyl]pyrrolidine-1-carbaldehyde;methanamine.
| Compound Name | 2,6-dimethylpyridine;3-[2-formyl-4-(2-propan-2-ylphenoxy)phenyl]pyrrolidine-1-carbaldehyde;methanamine |
|---|---|
| PubChem CID | 156815074 |
| Molecular Formula | C29H37N3O3 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | 2,6-dimethylpyridine;3-[2-formyl-4-(2-propan-2-ylphenoxy)phenyl]pyrrolidine-1-carbaldehyde;methanamine |
| SMILES | CC(C)c1ccccc1Oc1ccc(C2CCN(C=O)C2)c(C=O)c1.CN.Cc1cccc(C)n1 |
| InChI | InChI=1S/C21H23NO3.C7H9N.CH5N/c1-15(2)19-5-3-4-6-21(19)25-18-7-8-20(17(11-18)13-23)16-9-10-22(12-16)14-24;1-6-4-3-5-7(2)8-6;1-2/h3-8,11,13-16H,9-10,12H2,1-2H3;3-5H,1-2H3;2H2,1H3 |
| InChIKey | SQEWFKGCVAATTA-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|