C26H27ClN2O3 — CID 175576193
[2-[1-[(6-chloro-2-pyridinyl)methyl]pyrrolidin-3-yl]-5-(2-propan-2-ylphenoxy)phenyl] formate (PubChem CID 175576193) has the molecular formula C26H27ClN2O3 and a molecular weight of 450.97 g/mol. Its IUPAC name is [2-[1-[(6-chloro-2-pyridinyl)methyl]pyrrolidin-3-yl]-5-(2-propan-2-ylphenoxy)phenyl] formate.
| Compound Name | [2-[1-[(6-chloro-2-pyridinyl)methyl]pyrrolidin-3-yl]-5-(2-propan-2-ylphenoxy)phenyl] formate |
|---|---|
| PubChem CID | 175576193 |
| Molecular Formula | C26H27ClN2O3 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | [2-[1-[(6-chloro-2-pyridinyl)methyl]pyrrolidin-3-yl]-5-(2-propan-2-ylphenoxy)phenyl] formate |
| SMILES | CC(C)c1ccccc1Oc1ccc(C2CCN(Cc3cccc(Cl)n3)C2)c(OC=O)c1 |
| InChI | InChI=1S/C26H27ClN2O3/c1-18(2)22-7-3-4-8-24(22)32-21-10-11-23(25(14-21)31-17-30)19-12-13-29(15-19)16-20-6-5-9-26(27)28-20/h3-11,14,17-19H,12-13,15-16H2,1-2H3 |
| InChIKey | NNNKTMQXYCGZIJ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|