C18H19ClN4O3 — CID 15681749
(3E)-N-(4-chlorophenyl)-2,2-dimethyl-3-[(4-nitrophenyl)hydrazinylidene]butanamide (PubChem CID 15681749) has the molecular formula C18H19ClN4O3 and a molecular weight of 374.83 g/mol. Its IUPAC name is (3E)-N-(4-chlorophenyl)-2,2-dimethyl-3-[(4-nitrophenyl)hydrazinylidene]butanamide.
| Compound Name | (3E)-N-(4-chlorophenyl)-2,2-dimethyl-3-[(4-nitrophenyl)hydrazinylidene]butanamide |
|---|---|
| PubChem CID | 15681749 |
| Molecular Formula | C18H19ClN4O3 |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | (3E)-N-(4-chlorophenyl)-2,2-dimethyl-3-[(4-nitrophenyl)hydrazinylidene]butanamide |
| SMILES | C/C(=N\Nc1ccc([N+](=O)[O-])cc1)C(C)(C)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19ClN4O3/c1-12(21-22-15-8-10-16(11-9-15)23(25)26)18(2,3)17(24)20-14-6-4-13(19)5-7-14/h4-11,22H,1-3H3,(H,20,24)/b21-12+ |
| InChIKey | RKPBDXSCQDEACO-CIAFOILYSA-N |
| XLogP | 4.70 |
| TPSA | 96.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|