C21H23F3N6O — CID 156817943
2-[[4-[3-methoxy-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]-1,3,5-triazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene (PubChem CID 156817943) has the molecular formula C21H23F3N6O and a molecular weight of 432.45 g/mol. Its IUPAC name is 2-[[4-[3-methoxy-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]-1,3,5-triazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene.
| Compound Name | 2-[[4-[3-methoxy-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]-1,3,5-triazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene |
|---|---|
| PubChem CID | 156817943 |
| Molecular Formula | C21H23F3N6O |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 2-[[4-[3-methoxy-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]-1,3,5-triazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene |
| SMILES | COc1cc(C(F)(F)F)cnc1N1CCN(Cc2nc3nccc4c3n2CCC4)CC1 |
| InChI | InChI=1S/C21H23F3N6O/c1-31-16-11-15(21(22,23)24)12-26-20(16)29-9-7-28(8-10-29)13-17-27-19-18-14(4-5-25-19)3-2-6-30(17)18/h4-5,11-12H,2-3,6-10,13H2,1H3 |
| InChIKey | VLKJMBXKCZDVBN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |