C14H14N4 — CID 156819085
2-piperidin-1-yl-1,6-naphthyridine-7-carbonitrile (PubChem CID 156819085) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-piperidin-1-yl-1,6-naphthyridine-7-carbonitrile.
| Compound Name | 2-piperidin-1-yl-1,6-naphthyridine-7-carbonitrile |
|---|---|
| PubChem CID | 156819085 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-piperidin-1-yl-1,6-naphthyridine-7-carbonitrile |
| SMILES | N#Cc1cc2nc(N3CCCCC3)ccc2cn1 |
| InChI | InChI=1S/C14H14N4/c15-9-12-8-13-11(10-16-12)4-5-14(17-13)18-6-2-1-3-7-18/h4-5,8,10H,1-3,6-7H2 |
| InChIKey | MCCFMSQJONSMCR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |