C24H26N4O2S — CID 156819972
N-[[3-[3-[2-(methylamino)-1,3-thiazol-4-yl]phenyl]phenyl]methyl]-1-(3-oxopropyl)azetidine-3-carboxamide (PubChem CID 156819972) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is N-[[3-[3-[2-(methylamino)-1,3-thiazol-4-yl]phenyl]phenyl]methyl]-1-(3-oxopropyl)azetidine-3-carboxamide.
| Compound Name | N-[[3-[3-[2-(methylamino)-1,3-thiazol-4-yl]phenyl]phenyl]methyl]-1-(3-oxopropyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 156819972 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[[3-[3-[2-(methylamino)-1,3-thiazol-4-yl]phenyl]phenyl]methyl]-1-(3-oxopropyl)azetidine-3-carboxamide |
| SMILES | CNc1nc(-c2cccc(-c3cccc(CNC(=O)C4CN(CCC=O)C4)c3)c2)cs1 |
| InChI | InChI=1S/C24H26N4O2S/c1-25-24-27-22(16-31-24)20-8-3-7-19(12-20)18-6-2-5-17(11-18)13-26-23(30)21-14-28(15-21)9-4-10-29/h2-3,5-8,10-12,16,21H,4,9,13-15H2,1H3,(H,25,27)(H,26,30) |
| InChIKey | AFDJOKNUHMAUDL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|