C21H30N4O6 — CID 156820660
2-(2,6-dioxopiperidin-3-yl)-7-[2-[2-[methyl-[2-(methylamino)ethyl]amino]ethoxy]ethoxy]-4,5-dihydroisoindole-1,3-dione (PubChem CID 156820660) has the molecular formula C21H30N4O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-7-[2-[2-[methyl-[2-(methylamino)ethyl]amino]ethoxy]ethoxy]-4,5-dihydroisoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-7-[2-[2-[methyl-[2-(methylamino)ethyl]amino]ethoxy]ethoxy]-4,5-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 156820660 |
| Molecular Formula | C21H30N4O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-7-[2-[2-[methyl-[2-(methylamino)ethyl]amino]ethoxy]ethoxy]-4,5-dihydroisoindole-1,3-dione |
| SMILES | CNCCN(C)CCOCCOC1=CCCC2=C1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C21H30N4O6/c1-22-8-9-24(2)10-11-30-12-13-31-16-5-3-4-14-18(16)21(29)25(20(14)28)15-6-7-17(26)23-19(15)27/h5,15,22H,3-4,6-13H2,1-2H3,(H,23,26,27) |
| InChIKey | HDDBOSODZDVXEE-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|