C19H23N3O8 — CID 157021264
2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxyamino]isoindole-1,3-dione (PubChem CID 157021264) has the molecular formula C19H23N3O8 and a molecular weight of 421.41 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxyamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxyamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 157021264 |
| Molecular Formula | C19H23N3O8 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxyamino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NOCCOCCOCCO)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H23N3O8/c23-6-7-28-8-9-29-10-11-30-21-13-3-1-2-12-16(13)19(27)22(18(12)26)14-4-5-15(24)20-17(14)25/h1-3,14,21,23H,4-11H2,(H,20,24,25) |
| InChIKey | NXARHTSDTVLZDY-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|