C13H23N5O4 — CID 156823675
methyl 3-[(4-formamido-1-methylimidazole-2-carbonyl)amino]propanoate;propan-1-amine (PubChem CID 156823675) has the molecular formula C13H23N5O4 and a molecular weight of 313.36 g/mol. Its IUPAC name is methyl 3-[(4-formamido-1-methylimidazole-2-carbonyl)amino]propanoate;propan-1-amine.
| Compound Name | methyl 3-[(4-formamido-1-methylimidazole-2-carbonyl)amino]propanoate;propan-1-amine |
|---|---|
| PubChem CID | 156823675 |
| Molecular Formula | C13H23N5O4 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | methyl 3-[(4-formamido-1-methylimidazole-2-carbonyl)amino]propanoate;propan-1-amine |
| SMILES | CCCN.COC(=O)CCNC(=O)c1nc(NC=O)cn1C |
| InChI | InChI=1S/C10H14N4O4.C3H9N/c1-14-5-7(12-6-15)13-9(14)10(17)11-4-3-8(16)18-2;1-2-3-4/h5-6H,3-4H2,1-2H3,(H,11,17)(H,12,15);2-4H2,1H3 |
| InChIKey | ZLTSPARQQMTBDQ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 128.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|