C17H19BrN4O2 — CID 156825915
ethyl 1-[[6-(5-azaspiro[2.3]hexan-5-yl)-2-bromo-3-pyridinyl]methyl]imidazole-4-carboxylate (PubChem CID 156825915) has the molecular formula C17H19BrN4O2 and a molecular weight of 391.27 g/mol. Its IUPAC name is ethyl 1-[[6-(5-azaspiro[2.3]hexan-5-yl)-2-bromo-3-pyridinyl]methyl]imidazole-4-carboxylate.
| Compound Name | ethyl 1-[[6-(5-azaspiro[2.3]hexan-5-yl)-2-bromo-3-pyridinyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 156825915 |
| Molecular Formula | C17H19BrN4O2 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | ethyl 1-[[6-(5-azaspiro[2.3]hexan-5-yl)-2-bromo-3-pyridinyl]methyl]imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(Cc2ccc(N3CC4(CC4)C3)nc2Br)cn1 |
| InChI | InChI=1S/C17H19BrN4O2/c1-2-24-16(23)13-8-21(11-19-13)7-12-3-4-14(20-15(12)18)22-9-17(10-22)5-6-17/h3-4,8,11H,2,5-7,9-10H2,1H3 |
| InChIKey | IMCJGNFJMRHCBH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|