C16H18BrN5O2 — CID 156826700
ethyl 1-[[6-(5-azaspiro[2.3]hexan-5-yl)-2-bromo-3-pyridinyl]methyl]triazole-4-carboxylate (PubChem CID 156826700) has the molecular formula C16H18BrN5O2 and a molecular weight of 392.26 g/mol. Its IUPAC name is ethyl 1-[[6-(5-azaspiro[2.3]hexan-5-yl)-2-bromo-3-pyridinyl]methyl]triazole-4-carboxylate.
| Compound Name | ethyl 1-[[6-(5-azaspiro[2.3]hexan-5-yl)-2-bromo-3-pyridinyl]methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 156826700 |
| Molecular Formula | C16H18BrN5O2 |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | ethyl 1-[[6-(5-azaspiro[2.3]hexan-5-yl)-2-bromo-3-pyridinyl]methyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(Cc2ccc(N3CC4(CC4)C3)nc2Br)nn1 |
| InChI | InChI=1S/C16H18BrN5O2/c1-2-24-15(23)12-8-22(20-19-12)7-11-3-4-13(18-14(11)17)21-9-16(10-21)5-6-16/h3-4,8H,2,5-7,9-10H2,1H3 |
| InChIKey | CHDZUTVZOWDSIG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|