C19H21N3O6 — CID 156826772
4-[[4-[(2-methylpropan-2-yl)oxycarbonylcarbamoyl]quinolin-8-yl]amino]-4-oxobutanoic acid (PubChem CID 156826772) has the molecular formula C19H21N3O6 and a molecular weight of 387.39 g/mol. Its IUPAC name is 4-[[4-[(2-methylpropan-2-yl)oxycarbonylcarbamoyl]quinolin-8-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[4-[(2-methylpropan-2-yl)oxycarbonylcarbamoyl]quinolin-8-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 156826772 |
| Molecular Formula | C19H21N3O6 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 4-[[4-[(2-methylpropan-2-yl)oxycarbonylcarbamoyl]quinolin-8-yl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(=O)c1ccnc2c(NC(=O)CCC(=O)O)cccc12 |
| InChI | InChI=1S/C19H21N3O6/c1-19(2,3)28-18(27)22-17(26)12-9-10-20-16-11(12)5-4-6-13(16)21-14(23)7-8-15(24)25/h4-6,9-10H,7-8H2,1-3H3,(H,21,23)(H,24,25)(H,22,26,27) |
| InChIKey | HYHZRWQRLPZVHU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |