C21H20F3N3O3 — CID 156827782
methyl 2,3,5-trifluoro-4-[7-methyl-3-[[(2S)-morpholin-2-yl]methyl]imidazo[1,2-a]pyridin-2-yl]benzoate (PubChem CID 156827782) has the molecular formula C21H20F3N3O3 and a molecular weight of 419.40 g/mol. Its IUPAC name is methyl 2,3,5-trifluoro-4-[7-methyl-3-[[(2S)-morpholin-2-yl]methyl]imidazo[1,2-a]pyridin-2-yl]benzoate.
| Compound Name | methyl 2,3,5-trifluoro-4-[7-methyl-3-[[(2S)-morpholin-2-yl]methyl]imidazo[1,2-a]pyridin-2-yl]benzoate |
|---|---|
| PubChem CID | 156827782 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | methyl 2,3,5-trifluoro-4-[7-methyl-3-[[(2S)-morpholin-2-yl]methyl]imidazo[1,2-a]pyridin-2-yl]benzoate |
| SMILES | COC(=O)c1cc(F)c(-c2nc3cc(C)ccn3c2C[C@H]2CNCCO2)c(F)c1F |
| InChI | InChI=1S/C21H20F3N3O3/c1-11-3-5-27-15(8-12-10-25-4-6-30-12)20(26-16(27)7-11)17-14(22)9-13(21(28)29-2)18(23)19(17)24/h3,5,7,9,12,25H,4,6,8,10H2,1-2H3/t12-/m0/s1 |
| InChIKey | YPTIWQKGBIXLNW-LBPRGKRZSA-N |
| XLogP | 3.04 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|