C17H16F3NO7 — CID 156828434
[2-[2,3-dioxo-5-(trifluoromethoxy)indol-1-yl]acetyl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 156828434) has the molecular formula C17H16F3NO7 and a molecular weight of 403.31 g/mol. Its IUPAC name is [2-[2,3-dioxo-5-(trifluoromethoxy)indol-1-yl]acetyl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [2-[2,3-dioxo-5-(trifluoromethoxy)indol-1-yl]acetyl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 156828434 |
| Molecular Formula | C17H16F3NO7 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | [2-[2,3-dioxo-5-(trifluoromethoxy)indol-1-yl]acetyl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)CN1C(=O)C(=O)c2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C17H16F3NO7/c1-16(2,3)15(25)27-8-26-12(22)7-21-11-5-4-9(28-17(18,19)20)6-10(11)13(23)14(21)24/h4-6H,7-8H2,1-3H3 |
| InChIKey | OARUZELUIWTTDU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|