C21H27N5OS — CID 156828497
1-(6-aminocyclohepta-1,3-dien-1-yl)-3-[2-hydroxy-5-methyl-1-(2-methylpropyl)indol-3-yl]iminothiourea (PubChem CID 156828497) has the molecular formula C21H27N5OS and a molecular weight of 397.55 g/mol. Its IUPAC name is 1-(6-aminocyclohepta-1,3-dien-1-yl)-3-[2-hydroxy-5-methyl-1-(2-methylpropyl)indol-3-yl]iminothiourea.
| Compound Name | 1-(6-aminocyclohepta-1,3-dien-1-yl)-3-[2-hydroxy-5-methyl-1-(2-methylpropyl)indol-3-yl]iminothiourea |
|---|---|
| PubChem CID | 156828497 |
| Molecular Formula | C21H27N5OS |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 1-(6-aminocyclohepta-1,3-dien-1-yl)-3-[2-hydroxy-5-methyl-1-(2-methylpropyl)indol-3-yl]iminothiourea |
| SMILES | Cc1ccc2c(c1)c(/N=N/C(=S)NC1=CC=CCC(N)C1)c(O)n2CC(C)C |
| InChI | InChI=1S/C21H27N5OS/c1-13(2)12-26-18-9-8-14(3)10-17(18)19(20(26)27)24-25-21(28)23-16-7-5-4-6-15(22)11-16/h4-5,7-10,13,15,27H,6,11-12,22H2,1-3H3,(H,23,28)/b25-24+ |
| InChIKey | UGXOEYVVHYKUKH-OCOZRVBESA-N |
| XLogP | 4.83 |
| TPSA | 87.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|