C11H16N2O — CID 156829186
1-[(3E)-4-ethylhexa-1,3,5-trien-3-yl]imidazolidin-2-one (PubChem CID 156829186) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-[(3E)-4-ethylhexa-1,3,5-trien-3-yl]imidazolidin-2-one.
| Compound Name | 1-[(3E)-4-ethylhexa-1,3,5-trien-3-yl]imidazolidin-2-one |
|---|---|
| PubChem CID | 156829186 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-[(3E)-4-ethylhexa-1,3,5-trien-3-yl]imidazolidin-2-one |
| SMILES | C=C/C(CC)=C(\C=C)N1CCNC1=O |
| InChI | InChI=1S/C11H16N2O/c1-4-9(5-2)10(6-3)13-8-7-12-11(13)14/h4,6H,1,3,5,7-8H2,2H3,(H,12,14)/b10-9- |
| InChIKey | AFFPRYJEFWCURG-KTKRTIGZSA-N |
| XLogP | 2.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|