C11H6Cl3NO — CID 156830699
2,7-dichloro-3-methylquinoline-6-carbonyl chloride (PubChem CID 156830699) has the molecular formula C11H6Cl3NO and a molecular weight of 274.53 g/mol. Its IUPAC name is 2,7-dichloro-3-methylquinoline-6-carbonyl chloride.
| Compound Name | 2,7-dichloro-3-methylquinoline-6-carbonyl chloride |
|---|---|
| PubChem CID | 156830699 |
| Molecular Formula | C11H6Cl3NO |
| Molecular Weight | 274.53 g/mol |
| Exact Mass | 272.95 |
| IUPAC Name | 2,7-dichloro-3-methylquinoline-6-carbonyl chloride |
| SMILES | Cc1cc2cc(C(=O)Cl)c(Cl)cc2nc1Cl |
| InChI | InChI=1S/C11H6Cl3NO/c1-5-2-6-3-7(11(14)16)8(12)4-9(6)15-10(5)13/h2-4H,1H3 |
| InChIKey | WXBAUPHDMSSMEE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|