C23H19N3O4 — CID 156834078
3-[4-[4-(2,3-dimethoxyphenyl)phenyl]triazol-1-yl]benzoic acid (PubChem CID 156834078) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is 3-[4-[4-(2,3-dimethoxyphenyl)phenyl]triazol-1-yl]benzoic acid.
| Compound Name | 3-[4-[4-(2,3-dimethoxyphenyl)phenyl]triazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 156834078 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 3-[4-[4-(2,3-dimethoxyphenyl)phenyl]triazol-1-yl]benzoic acid |
| SMILES | COc1cccc(-c2ccc(-c3cn(-c4cccc(C(=O)O)c4)nn3)cc2)c1OC |
| InChI | InChI=1S/C23H19N3O4/c1-29-21-8-4-7-19(22(21)30-2)15-9-11-16(12-10-15)20-14-26(25-24-20)18-6-3-5-17(13-18)23(27)28/h3-14H,1-2H3,(H,27,28) |
| InChIKey | QPWUHCMOWIKXGH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |