C14H25N3O3 — CID 156834371
tert-butyl 2-[[(3R,6S)-6-cyanopiperidin-3-yl]amino]oxy-2-methylpropanoate (PubChem CID 156834371) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is tert-butyl 2-[[(3R,6S)-6-cyanopiperidin-3-yl]amino]oxy-2-methylpropanoate.
| Compound Name | tert-butyl 2-[[(3R,6S)-6-cyanopiperidin-3-yl]amino]oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 156834371 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | tert-butyl 2-[[(3R,6S)-6-cyanopiperidin-3-yl]amino]oxy-2-methylpropanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C)ON[C@@H]1CC[C@@H](C#N)NC1 |
| InChI | InChI=1S/C14H25N3O3/c1-13(2,3)19-12(18)14(4,5)20-17-11-7-6-10(8-15)16-9-11/h10-11,16-17H,6-7,9H2,1-5H3/t10-,11+/m0/s1 |
| InChIKey | CVMZSRFWEOMTLY-WDEREUQCSA-N |
| XLogP | 1.27 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|