C13H23N3O3 — CID 156834577
tert-butyl 2-[[(6S)-6-cyano-1-methylpiperidin-3-yl]amino]oxyacetate (PubChem CID 156834577) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is tert-butyl 2-[[(6S)-6-cyano-1-methylpiperidin-3-yl]amino]oxyacetate.
| Compound Name | tert-butyl 2-[[(6S)-6-cyano-1-methylpiperidin-3-yl]amino]oxyacetate |
|---|---|
| PubChem CID | 156834577 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | tert-butyl 2-[[(6S)-6-cyano-1-methylpiperidin-3-yl]amino]oxyacetate |
| SMILES | CN1CC(NOCC(=O)OC(C)(C)C)CC[C@H]1C#N |
| InChI | InChI=1S/C13H23N3O3/c1-13(2,3)19-12(17)9-18-15-10-5-6-11(7-14)16(4)8-10/h10-11,15H,5-6,8-9H2,1-4H3/t10?,11-/m0/s1 |
| InChIKey | DWQKVJFMNYRHMT-DTIOYNMSSA-N |
| XLogP | 0.84 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|