C15H29N3O3 — CID 156834592
tert-butyl 2-methyl-2-[(1-methylpiperidin-3-yl)amino]oxypropanoate;formonitrile (PubChem CID 156834592) has the molecular formula C15H29N3O3 and a molecular weight of 299.41 g/mol. Its IUPAC name is tert-butyl 2-methyl-2-[(1-methylpiperidin-3-yl)amino]oxypropanoate;formonitrile.
| Compound Name | tert-butyl 2-methyl-2-[(1-methylpiperidin-3-yl)amino]oxypropanoate;formonitrile |
|---|---|
| PubChem CID | 156834592 |
| Molecular Formula | C15H29N3O3 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | tert-butyl 2-methyl-2-[(1-methylpiperidin-3-yl)amino]oxypropanoate;formonitrile |
| SMILES | C#N.CN1CCCC(NOC(C)(C)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H28N2O3.CHN/c1-13(2,3)18-12(17)14(4,5)19-15-11-8-7-9-16(6)10-11;1-2/h11,15H,7-10H2,1-6H3;1H |
| InChIKey | CLNRJFGXYMCJLJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|