C25H34N5O9P — CID 156835724
3-methoxypropyl (2S)-2-[[[(2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 156835724) has the molecular formula C25H34N5O9P and a molecular weight of 579.55 g/mol. Its IUPAC name is 3-methoxypropyl (2S)-2-[[[(2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 3-methoxypropyl (2S)-2-[[[(2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156835724 |
| Molecular Formula | C25H34N5O9P |
| Molecular Weight | 579.55 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | 3-methoxypropyl (2S)-2-[[[(2R,3S,4S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-2-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COCCCOC(=O)[C@H](C)NP(=O)(OC[C@@]1(C)OC[C@@](O)(c2ccc3c(N)ncnn23)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C25H34N5O9P/c1-17(22(31)36-13-7-12-35-3)29-40(34,39-18-8-5-4-6-9-18)38-14-24(2)23(32)25(33,15-37-24)20-11-10-19-21(26)27-16-28-30(19)20/h4-6,8-11,16-17,23,32-33H,7,12-15H2,1-3H3,(H,29,34)(H2,26,27,28)/t17-,23+,24+,25+,40?/m0/s1 |
| InChIKey | CBWXYOBSNXSRSU-KWIWQCMQSA-N |
| XLogP | 1.41 |
| TPSA | 188.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.55 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|