C14H21ClF3N3 — CID 156837396
(1E,3Z)-2-chloro-N',7-dimethyl-3-[(Z)-4,4,4-trifluoro-3-iminobut-1-enyl]octa-1,3-diene-1,8-diamine (PubChem CID 156837396) has the molecular formula C14H21ClF3N3 and a molecular weight of 323.79 g/mol. Its IUPAC name is (1E,3Z)-2-chloro-N',7-dimethyl-3-[(Z)-4,4,4-trifluoro-3-iminobut-1-enyl]octa-1,3-diene-1,8-diamine.
| Compound Name | (1E,3Z)-2-chloro-N',7-dimethyl-3-[(Z)-4,4,4-trifluoro-3-iminobut-1-enyl]octa-1,3-diene-1,8-diamine |
|---|---|
| PubChem CID | 156837396 |
| Molecular Formula | C14H21ClF3N3 |
| Molecular Weight | 323.79 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (1E,3Z)-2-chloro-N',7-dimethyl-3-[(Z)-4,4,4-trifluoro-3-iminobut-1-enyl]octa-1,3-diene-1,8-diamine |
| SMILES | [H]/N=C(/C=C\C(=C\CCC(C)CNC)\C(Cl)=C/N)C(F)(F)F |
| InChI | InChI=1S/C14H21ClF3N3/c1-10(9-21-2)4-3-5-11(12(15)8-19)6-7-13(20)14(16,17)18/h5-8,10,20-21H,3-4,9,19H2,1-2H3/b7-6-,11-5-,12-8+,20-13- |
| InChIKey | URQRDJYUZDSYMH-CFEJEUFUSA-N |
| XLogP | 3.73 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.79 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|