C13H21F3N2 — CID 156837554
(5E,7Z)-10,10,10-trifluoro-9-imino-N,2,6-trimethyldeca-5,7-dien-1-amine (PubChem CID 156837554) has the molecular formula C13H21F3N2 and a molecular weight of 262.32 g/mol. Its IUPAC name is (5E,7Z)-10,10,10-trifluoro-9-imino-N,2,6-trimethyldeca-5,7-dien-1-amine.
| Compound Name | (5E,7Z)-10,10,10-trifluoro-9-imino-N,2,6-trimethyldeca-5,7-dien-1-amine |
|---|---|
| PubChem CID | 156837554 |
| Molecular Formula | C13H21F3N2 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (5E,7Z)-10,10,10-trifluoro-9-imino-N,2,6-trimethyldeca-5,7-dien-1-amine |
| SMILES | [H]/N=C(/C=C\C(C)=C\CCC(C)CNC)C(F)(F)F |
| InChI | InChI=1S/C13H21F3N2/c1-10(5-4-6-11(2)9-18-3)7-8-12(17)13(14,15)16/h5,7-8,11,17-18H,4,6,9H2,1-3H3/b8-7-,10-5+,17-12- |
| InChIKey | JMYZGRNNKROTAT-JGVCJVRHSA-N |
| XLogP | 3.71 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|