C16H26N2 — CID 145198925
(3E)-3-ethyl-2-imino-N-methylhexa-3,5-dien-1-amine;5-methylcyclohexa-1,3-diene (PubChem CID 145198925) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is (3E)-3-ethyl-2-imino-N-methylhexa-3,5-dien-1-amine;5-methylcyclohexa-1,3-diene.
| Compound Name | (3E)-3-ethyl-2-imino-N-methylhexa-3,5-dien-1-amine;5-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 145198925 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | (3E)-3-ethyl-2-imino-N-methylhexa-3,5-dien-1-amine;5-methylcyclohexa-1,3-diene |
| SMILES | CC1C=CC=CC1.[H]/N=C(CNC)/C(=C/C=C)CC |
| InChI | InChI=1S/C9H16N2.C7H10/c1-4-6-8(5-2)9(10)7-11-3;1-7-5-3-2-4-6-7/h4,6,10-11H,1,5,7H2,2-3H3;2-5,7H,6H2,1H3/b8-6+,10-9+; |
| InChIKey | GACRBYUCTBZVEB-JTBRFJDCSA-N |
| XLogP | 3.89 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|