C20H25N3O8S — CID 156838471
methyl 2-[[[1-(6-ethoxy-5-methoxy-2-pyridinyl)-2-methylsulfonylethyl]amino]methyl]-6-nitrobenzoate (PubChem CID 156838471) has the molecular formula C20H25N3O8S and a molecular weight of 467.50 g/mol. Its IUPAC name is methyl 2-[[[1-(6-ethoxy-5-methoxy-2-pyridinyl)-2-methylsulfonylethyl]amino]methyl]-6-nitrobenzoate.
| Compound Name | methyl 2-[[[1-(6-ethoxy-5-methoxy-2-pyridinyl)-2-methylsulfonylethyl]amino]methyl]-6-nitrobenzoate |
|---|---|
| PubChem CID | 156838471 |
| Molecular Formula | C20H25N3O8S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | methyl 2-[[[1-(6-ethoxy-5-methoxy-2-pyridinyl)-2-methylsulfonylethyl]amino]methyl]-6-nitrobenzoate |
| SMILES | CCOc1nc(C(CS(C)(=O)=O)NCc2cccc([N+](=O)[O-])c2C(=O)OC)ccc1OC |
| InChI | InChI=1S/C20H25N3O8S/c1-5-31-19-17(29-2)10-9-14(22-19)15(12-32(4,27)28)21-11-13-7-6-8-16(23(25)26)18(13)20(24)30-3/h6-10,15,21H,5,11-12H2,1-4H3 |
| InChIKey | XTDFQUOOODMPJG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 146.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|