About N-(3,5-dichlorophenyl)-2-methoxy-N'-[4-[methoxy(methyl)amino]-4-oxobutyl]propanediamide
N-(3,5-dichlorophenyl)-2-methoxy-N'-[4-[methoxy(methyl)amino]-4-oxobutyl]propanediamide (PubChem CID 156838791) has the molecular formula C16H21Cl2N3O5
and a molecular weight of 406.27 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-methoxy-N'-[4-[methoxy(methyl)amino]-4-oxobutyl]propanediamide.
Molecular Properties
| Compound Name | N-(3,5-dichlorophenyl)-2-methoxy-N'-[4-[methoxy(methyl)amino]-4-oxobutyl]propanediamide |
| PubChem CID | 156838791 |
| Molecular Formula | C16H21Cl2N3O5 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-methoxy-N'-[4-[methoxy(methyl)amino]-4-oxobutyl]propanediamide |
| SMILES | COC(C(=O)NCCCC(=O)N(C)OC)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H21Cl2N3O5/c1-21(26-3)13(22)5-4-6-19-15(23)14(25-2)16(24)20-12-8-10(17)7-11(18)9-12/h7-9,14H,4-6H2,1-3H3,(H,19,23)(H,20,24) |
| InChIKey | XTBKVAFWQSZBMQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3,5-dichlorophenyl)-2-methoxy-N'-[4-[methoxy(methyl)amino]-4-oxobutyl]propanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dichlorophenyl)-2-methoxy-N'-[4-[methoxy(methyl)amino]-4-oxobutyl]propanediamide?
The IUPAC name of N-(3,5-dichlorophenyl)-2-methoxy-N'-[4-[methoxy(methyl)amino]-4-oxobutyl]propanediamide (CID 156838791) is N-(3,5-dichlorophenyl)-2-methoxy-N'-[4-[methoxy(methyl)amino]-4-oxobutyl]propanediamide.
What is the SMILES notation for N-(3,5-dichlorophenyl)-2-methoxy-N'-[4-[methoxy(methyl)amino]-4-oxobutyl]propanediamide?
The canonical SMILES for N-(3,5-dichlorophenyl)-2-methoxy-N'-[4-[methoxy(methyl)amino]-4-oxobutyl]propanediamide is COC(C(=O)NCCCC(=O)N(C)OC)C(=O)Nc1cc(Cl)cc(Cl)c1.
What is the InChIKey of N-(3,5-dichlorophenyl)-2-methoxy-N'-[4-[methoxy(methyl)amino]-4-oxobutyl]propanediamide?
The InChIKey is XTBKVAFWQSZBMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21Cl2N3O5/c1-21(26-3)13(22)5-4-6-19-15(23)14(25-2)16(24)20-12-8-10(17)7-11(18)9-12/h7-9,14H,4-6H2,1-3H3,(H,19,23)(H,20,24).
What are the key properties of N-(3,5-dichlorophenyl)-2-methoxy-N'-[4-[methoxy(methyl)amino]-4-oxobutyl]propanediamide?
N-(3,5-dichlorophenyl)-2-methoxy-N'-[4-[methoxy(methyl)amino]-4-oxobutyl]propanediamide has a molecular weight of 406.27 g/mol, XLogP of 1.86, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dichlorophenyl)-2-methoxy-N'-[4-[methoxy(methyl)amino]-4-oxobutyl]propanediamide is sourced from PubChem (CID 156838791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).