C10H10BrClN2O3 — CID 176670162
N'-(3-bromo-5-chlorophenyl)-2-methoxypropanediamide (PubChem CID 176670162) has the molecular formula C10H10BrClN2O3 and a molecular weight of 321.56 g/mol. Its IUPAC name is N'-(3-bromo-5-chlorophenyl)-2-methoxypropanediamide.
| Compound Name | N'-(3-bromo-5-chlorophenyl)-2-methoxypropanediamide |
|---|---|
| PubChem CID | 176670162 |
| Molecular Formula | C10H10BrClN2O3 |
| Molecular Weight | 321.56 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | N'-(3-bromo-5-chlorophenyl)-2-methoxypropanediamide |
| SMILES | COC(C(N)=O)C(=O)Nc1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C10H10BrClN2O3/c1-17-8(9(13)15)10(16)14-7-3-5(11)2-6(12)4-7/h2-4,8H,1H3,(H2,13,15)(H,14,16) |
| InChIKey | WWRWYOAQKZJLQJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.56 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|