C21H29N3 — CID 156841297
N-(2-piperidin-1-ylethyl)-1-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)ethenamine (PubChem CID 156841297) has the molecular formula C21H29N3 and a molecular weight of 323.48 g/mol. Its IUPAC name is N-(2-piperidin-1-ylethyl)-1-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)ethenamine.
| Compound Name | N-(2-piperidin-1-ylethyl)-1-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)ethenamine |
|---|---|
| PubChem CID | 156841297 |
| Molecular Formula | C21H29N3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | N-(2-piperidin-1-ylethyl)-1-(6,7,8,9-tetrahydro-5H-carbazol-3-yl)ethenamine |
| SMILES | C=C(NCCN1CCCCC1)c1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C21H29N3/c1-16(22-11-14-24-12-5-2-6-13-24)17-9-10-21-19(15-17)18-7-3-4-8-20(18)23-21/h9-10,15,22-23H,1-8,11-14H2 |
| InChIKey | ADABWDJZZDLBCO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|