C20H26NO3P — CID 156844262
4-[(1S)-1-cyclopropyl-2-[ethoxy(methyl)phosphoryl]ethyl]-2-phenylmethoxypyridine (PubChem CID 156844262) has the molecular formula C20H26NO3P and a molecular weight of 359.41 g/mol. Its IUPAC name is 4-[(1S)-1-cyclopropyl-2-[ethoxy(methyl)phosphoryl]ethyl]-2-phenylmethoxypyridine.
| Compound Name | 4-[(1S)-1-cyclopropyl-2-[ethoxy(methyl)phosphoryl]ethyl]-2-phenylmethoxypyridine |
|---|---|
| PubChem CID | 156844262 |
| Molecular Formula | C20H26NO3P |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 4-[(1S)-1-cyclopropyl-2-[ethoxy(methyl)phosphoryl]ethyl]-2-phenylmethoxypyridine |
| SMILES | CCOP(C)(=O)C[C@H](c1ccnc(OCc2ccccc2)c1)C1CC1 |
| InChI | InChI=1S/C20H26NO3P/c1-3-24-25(2,22)15-19(17-9-10-17)18-11-12-21-20(13-18)23-14-16-7-5-4-6-8-16/h4-8,11-13,17,19H,3,9-10,14-15H2,1-2H3/t19-,25?/m0/s1 |
| InChIKey | VTVQLMSNCIJBJY-UBDBMELISA-N |
| XLogP | 5.10 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|