C14H11N7 — CID 156845042
6-[6-(methylamino)pyridazin-3-yl]-3-(1H-pyrazol-4-yl)pyridine-2-carbonitrile (PubChem CID 156845042) has the molecular formula C14H11N7 and a molecular weight of 277.29 g/mol. Its IUPAC name is 6-[6-(methylamino)pyridazin-3-yl]-3-(1H-pyrazol-4-yl)pyridine-2-carbonitrile.
| Compound Name | 6-[6-(methylamino)pyridazin-3-yl]-3-(1H-pyrazol-4-yl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 156845042 |
| Molecular Formula | C14H11N7 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 6-[6-(methylamino)pyridazin-3-yl]-3-(1H-pyrazol-4-yl)pyridine-2-carbonitrile |
| SMILES | CNc1ccc(-c2ccc(-c3cn[nH]c3)c(C#N)n2)nn1 |
| InChI | InChI=1S/C14H11N7/c1-16-14-5-4-12(20-21-14)11-3-2-10(13(6-15)19-11)9-7-17-18-8-9/h2-5,7-8H,1H3,(H,16,21)(H,17,18) |
| InChIKey | CYIXKXMHEICPTE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |