C24H21N3O3 — CID 15684623
3,6-dimethyl-2-[(E)-2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]imidazo[1,2-a]pyridine (PubChem CID 15684623) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 3,6-dimethyl-2-[(E)-2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]imidazo[1,2-a]pyridine.
| Compound Name | 3,6-dimethyl-2-[(E)-2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 15684623 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 3,6-dimethyl-2-[(E)-2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]imidazo[1,2-a]pyridine |
| SMILES | Cc1ccc2nc(/C=C/c3ccc([N+](=O)[O-])c(OCc4ccccc4)c3)c(C)n2c1 |
| InChI | InChI=1S/C24H21N3O3/c1-17-8-13-24-25-21(18(2)26(24)15-17)11-9-19-10-12-22(27(28)29)23(14-19)30-16-20-6-4-3-5-7-20/h3-15H,16H2,1-2H3/b11-9+ |
| InChIKey | HLXMUYXKHOGCSW-PKNBQFBNSA-N |
| XLogP | 5.61 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|