C30H25N3O4 — CID 54572134
3-methyl-2-[2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]-7-phenylmethoxyimidazo[1,2-a]pyridine (PubChem CID 54572134) has the molecular formula C30H25N3O4 and a molecular weight of 491.55 g/mol. Its IUPAC name is 3-methyl-2-[2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]-7-phenylmethoxyimidazo[1,2-a]pyridine.
| Compound Name | 3-methyl-2-[2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]-7-phenylmethoxyimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 54572134 |
| Molecular Formula | C30H25N3O4 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 3-methyl-2-[2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]-7-phenylmethoxyimidazo[1,2-a]pyridine |
| SMILES | Cc1c(C=Cc2ccc([N+](=O)[O-])c(OCc3ccccc3)c2)nc2cc(OCc3ccccc3)ccn12 |
| InChI | InChI=1S/C30H25N3O4/c1-22-27(31-30-19-26(16-17-32(22)30)36-20-24-8-4-2-5-9-24)14-12-23-13-15-28(33(34)35)29(18-23)37-21-25-10-6-3-7-11-25/h2-19H,20-21H2,1H3 |
| InChIKey | ZYASXFGOMGHFAX-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|