About 2-[2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]imidazo[1,2-a]pyridine
2-[2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]imidazo[1,2-a]pyridine (PubChem CID 54000152) has the molecular formula C22H17N3O3
and a molecular weight of 371.40 g/mol. Its IUPAC name is 2-[2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 2-[2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]imidazo[1,2-a]pyridine |
| PubChem CID | 54000152 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2-[2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]imidazo[1,2-a]pyridine |
| SMILES | O=[N+]([O-])c1ccc(C=Cc2cn3ccccc3n2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C22H17N3O3/c26-25(27)20-12-10-17(14-21(20)28-16-18-6-2-1-3-7-18)9-11-19-15-24-13-5-4-8-22(24)23-19/h1-15H,16H2 |
| InChIKey | KKZHPASUTHBTMY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]imidazo[1,2-a]pyridine?
The IUPAC name of 2-[2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]imidazo[1,2-a]pyridine (CID 54000152) is 2-[2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]imidazo[1,2-a]pyridine.
What is the SMILES notation for 2-[2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]imidazo[1,2-a]pyridine?
The canonical SMILES for 2-[2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]imidazo[1,2-a]pyridine is O=[N+]([O-])c1ccc(C=Cc2cn3ccccc3n2)cc1OCc1ccccc1.
What is the InChIKey of 2-[2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]imidazo[1,2-a]pyridine?
The InChIKey is KKZHPASUTHBTMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3O3/c26-25(27)20-12-10-17(14-21(20)28-16-18-6-2-1-3-7-18)9-11-19-15-24-13-5-4-8-22(24)23-19/h1-15H,16H2.
What are the key properties of 2-[2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]imidazo[1,2-a]pyridine?
2-[2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]imidazo[1,2-a]pyridine has a molecular weight of 371.40 g/mol, XLogP of 4.99, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-nitro-3-phenylmethoxyphenyl)ethenyl]imidazo[1,2-a]pyridine is sourced from PubChem (CID 54000152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).